C17H25NO2 — CID 134918054
(E)-N-hexyl-2-methoxy-4-phenylbut-3-enamide (PubChem CID 134918054) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (E)-N-hexyl-2-methoxy-4-phenylbut-3-enamide.
| Compound Name | (E)-N-hexyl-2-methoxy-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 134918054 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (E)-N-hexyl-2-methoxy-4-phenylbut-3-enamide |
| SMILES | CCCCCCNC(=O)C(/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C17H25NO2/c1-3-4-5-9-14-18-17(19)16(20-2)13-12-15-10-7-6-8-11-15/h6-8,10-13,16H,3-5,9,14H2,1-2H3,(H,18,19)/b13-12+ |
| InChIKey | ZNOXTCYXHPXDAA-OUKQBFOZSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|