C20H21F2N3O3 — CID 134918115
4-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]oxane-4-carboxamide (PubChem CID 134918115) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]oxane-4-carboxamide.
| Compound Name | 4-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 134918115 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]oxane-4-carboxamide |
| SMILES | O=C(CNC(=O)C1(Nc2ccc(F)cc2)CCOCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21F2N3O3/c21-14-1-5-16(6-2-14)24-18(26)13-23-19(27)20(9-11-28-12-10-20)25-17-7-3-15(22)4-8-17/h1-8,25H,9-13H2,(H,23,27)(H,24,26) |
| InChIKey | KWZLQLJWRLGVIP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |