C22H25F2N3O2 — CID 134917874
1-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]cycloheptane-1-carboxamide (PubChem CID 134917874) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]cycloheptane-1-carboxamide.
| Compound Name | 1-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 134917874 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-(4-fluoroanilino)-N-[2-(4-fluoroanilino)-2-oxoethyl]cycloheptane-1-carboxamide |
| SMILES | O=C(CNC(=O)C1(Nc2ccc(F)cc2)CCCCCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H25F2N3O2/c23-16-5-9-18(10-6-16)26-20(28)15-25-21(29)22(13-3-1-2-4-14-22)27-19-11-7-17(24)8-12-19/h5-12,27H,1-4,13-15H2,(H,25,29)(H,26,28) |
| InChIKey | YTZGGAONPJGRCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |