C20H20BrNO3 — CID 134918534
methyl (2R,3R)-2-benzamido-3-(2-bromophenyl)-2-methylpent-4-enoate (PubChem CID 134918534) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is methyl (2R,3R)-2-benzamido-3-(2-bromophenyl)-2-methylpent-4-enoate.
| Compound Name | methyl (2R,3R)-2-benzamido-3-(2-bromophenyl)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 134918534 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | methyl (2R,3R)-2-benzamido-3-(2-bromophenyl)-2-methylpent-4-enoate |
| SMILES | C=C[C@H](c1ccccc1Br)[C@@](C)(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H20BrNO3/c1-4-16(15-12-8-9-13-17(15)21)20(2,19(24)25-3)22-18(23)14-10-6-5-7-11-14/h4-13,16H,1H2,2-3H3,(H,22,23)/t16-,20-/m1/s1 |
| InChIKey | RLXBFPUPXGEHAD-OXQOHEQNSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|