C23H36O4 — CID 134918884
ethyl (3aR,5E,8E,12E,15aS)-2,2,3a,9,13-pentamethyl-7,10,11,14,15,15a-hexahydro-4H-cyclotetradeca[d][1,3]dioxole-6-carboxylate (PubChem CID 134918884) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is ethyl (3aR,5E,8E,12E,15aS)-2,2,3a,9,13-pentamethyl-7,10,11,14,15,15a-hexahydro-4H-cyclotetradeca[d][1,3]dioxole-6-carboxylate.
| Compound Name | ethyl (3aR,5E,8E,12E,15aS)-2,2,3a,9,13-pentamethyl-7,10,11,14,15,15a-hexahydro-4H-cyclotetradeca[d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 134918884 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | ethyl (3aR,5E,8E,12E,15aS)-2,2,3a,9,13-pentamethyl-7,10,11,14,15,15a-hexahydro-4H-cyclotetradeca[d][1,3]dioxole-6-carboxylate |
| SMILES | CCOC(=O)/C1=C/C[C@@]2(C)OC(C)(C)O[C@H]2CC/C(C)=C/CC/C(C)=C/C1 |
| InChI | InChI=1S/C23H36O4/c1-7-25-21(24)19-13-11-17(2)9-8-10-18(3)12-14-20-23(6,16-15-19)27-22(4,5)26-20/h10-11,15,20H,7-9,12-14,16H2,1-6H3/b17-11+,18-10+,19-15+/t20-,23+/m0/s1 |
| InChIKey | KZCSWQZMDMNBES-VBSXXJGASA-N |
| XLogP | 5.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|