C23H36O6 — CID 11361830
ethyl (E)-3-[(2S,4R,5S)-5-[(E)-9-hydroxy-3-methylnon-3-en-7-ynyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate (PubChem CID 11361830) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,4R,5S)-5-[(E)-9-hydroxy-3-methylnon-3-en-7-ynyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,4R,5S)-5-[(E)-9-hydroxy-3-methylnon-3-en-7-ynyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11361830 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | ethyl (E)-3-[(2S,4R,5S)-5-[(E)-9-hydroxy-3-methylnon-3-en-7-ynyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H]1C[C@@](C)(OCOC)[C@H](CC/C(C)=C/CCC#CCO)O1 |
| InChI | InChI=1S/C23H36O6/c1-6-27-22(25)19(3)15-20-16-23(4,28-17-26-5)21(29-20)13-12-18(2)11-9-7-8-10-14-24/h11,15,20-21,24H,6-7,9,12-14,16-17H2,1-5H3/b18-11+,19-15+/t20-,21+,23-/m1/s1 |
| InChIKey | BYMMYPXQTOJZOK-FUBSOAOJSA-N |
| XLogP | 3.53 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|