C21H38O4 — CID 14780922
ethyl (E)-4-[(4S)-2,2-dimethyl-4-nonyl-1,3-dioxolan-4-yl]-2-methylbut-2-enoate (PubChem CID 14780922) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is ethyl (E)-4-[(4S)-2,2-dimethyl-4-nonyl-1,3-dioxolan-4-yl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(4S)-2,2-dimethyl-4-nonyl-1,3-dioxolan-4-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14780922 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | ethyl (E)-4-[(4S)-2,2-dimethyl-4-nonyl-1,3-dioxolan-4-yl]-2-methylbut-2-enoate |
| SMILES | CCCCCCCCC[C@]1(C/C=C(\C)C(=O)OCC)COC(C)(C)O1 |
| InChI | InChI=1S/C21H38O4/c1-6-8-9-10-11-12-13-15-21(17-24-20(4,5)25-21)16-14-18(3)19(22)23-7-2/h14H,6-13,15-17H2,1-5H3/b18-14+/t21-/m0/s1 |
| InChIKey | NBPOSTYOWRZKDR-TVADFSRQSA-N |
| XLogP | 5.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|