C20H34O4 — CID 11359710
(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2-nonyl-3H-pyran-6-one (PubChem CID 11359710) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2-nonyl-3H-pyran-6-one.
| Compound Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2-nonyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 11359710 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2-nonyl-3H-pyran-6-one |
| SMILES | CCCCCCCCC[C@@]1([C@H]2COC(C)(C)O2)CC=C(C)C(=O)O1 |
| InChI | InChI=1S/C20H34O4/c1-5-6-7-8-9-10-11-13-20(14-12-16(2)18(21)24-20)17-15-22-19(3,4)23-17/h12,17H,5-11,13-15H2,1-4H3/t17-,20+/m1/s1 |
| InChIKey | LDNUZWLWDUADCV-XLIONFOSSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|