C23H38O8 — CID 11259288
ethyl (E)-3-[(2S,4R,5S)-4-(methoxymethoxy)-4-methyl-5-[(3S,4S)-3,4,9-trihydroxy-3-methylnon-7-ynyl]oxolan-2-yl]-2-methylprop-2-enoate (PubChem CID 11259288) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,4R,5S)-4-(methoxymethoxy)-4-methyl-5-[(3S,4S)-3,4,9-trihydroxy-3-methylnon-7-ynyl]oxolan-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,4R,5S)-4-(methoxymethoxy)-4-methyl-5-[(3S,4S)-3,4,9-trihydroxy-3-methylnon-7-ynyl]oxolan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11259288 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | ethyl (E)-3-[(2S,4R,5S)-4-(methoxymethoxy)-4-methyl-5-[(3S,4S)-3,4,9-trihydroxy-3-methylnon-7-ynyl]oxolan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H]1C[C@@](C)(OCOC)[C@H](CC[C@](C)(O)[C@@H](O)CCC#CCO)O1 |
| InChI | InChI=1S/C23H38O8/c1-6-29-21(26)17(2)14-18-15-23(4,30-16-28-5)20(31-18)11-12-22(3,27)19(25)10-8-7-9-13-24/h14,18-20,24-25,27H,6,8,10-13,15-16H2,1-5H3/b17-14+/t18-,19+,20+,22+,23-/m1/s1 |
| InChIKey | GOAQDEKJCVCKEH-QWFUBMEXSA-N |
| XLogP | 1.70 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|