C19H30O5 — CID 24805382
prop-2-enyl (E,5S,6S,7R)-5-hydroxy-7-(methoxymethoxy)-2,6-dimethyldodec-2-en-11-ynoate (PubChem CID 24805382) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is prop-2-enyl (E,5S,6S,7R)-5-hydroxy-7-(methoxymethoxy)-2,6-dimethyldodec-2-en-11-ynoate.
| Compound Name | prop-2-enyl (E,5S,6S,7R)-5-hydroxy-7-(methoxymethoxy)-2,6-dimethyldodec-2-en-11-ynoate |
|---|---|
| PubChem CID | 24805382 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | prop-2-enyl (E,5S,6S,7R)-5-hydroxy-7-(methoxymethoxy)-2,6-dimethyldodec-2-en-11-ynoate |
| SMILES | C#CCCC[C@@H](OCOC)[C@@H](C)[C@@H](O)C/C=C(\C)C(=O)OCC=C |
| InChI | InChI=1S/C19H30O5/c1-6-8-9-10-18(24-14-22-5)16(4)17(20)12-11-15(3)19(21)23-13-7-2/h1,7,11,16-18,20H,2,8-10,12-14H2,3-5H3/b15-11+/t16-,17-,18+/m0/s1 |
| InChIKey | YLWDETDSORVRMK-YJRLUFNCSA-N |
| XLogP | 2.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|