C14H22O4 — CID 91537567
5,7-dihydroxy-2,6-dimethyldodec-2-en-11-ynoic acid (PubChem CID 91537567) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 5,7-dihydroxy-2,6-dimethyldodec-2-en-11-ynoic acid.
| Compound Name | 5,7-dihydroxy-2,6-dimethyldodec-2-en-11-ynoic acid |
|---|---|
| PubChem CID | 91537567 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5,7-dihydroxy-2,6-dimethyldodec-2-en-11-ynoic acid |
| SMILES | C#CCCCC(O)C(C)C(O)CC=C(C)C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-4-5-6-7-12(15)11(3)13(16)9-8-10(2)14(17)18/h1,8,11-13,15-16H,5-7,9H2,2-3H3,(H,17,18) |
| InChIKey | DTBMDFGMMMHQPD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|