C15H22O4 — CID 138980714
methyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-methylbut-3-ynyl]oxan-2-yl]but-2-enoate (PubChem CID 138980714) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-methylbut-3-ynyl]oxan-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-methylbut-3-ynyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 138980714 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-methylbut-3-ynyl]oxan-2-yl]but-2-enoate |
| SMILES | C#C[C@H](C)C[C@@H]1C[C@H](O)C[C@H](C/C=C/C(=O)OC)O1 |
| InChI | InChI=1S/C15H22O4/c1-4-11(2)8-14-10-12(16)9-13(19-14)6-5-7-15(17)18-3/h1,5,7,11-14,16H,6,8-10H2,2-3H3/b7-5+/t11-,12+,13-,14+/m0/s1 |
| InChIKey | ZJJMVIPHYSKEAJ-BIGGRHPBSA-N |
| XLogP | 1.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|