C26H42O8 — CID 101056951
ethyl (Z)-3-[(2S,4R,5S)-5-[2-[(4S,5S)-5-(5-hydroxypent-3-ynyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate (PubChem CID 101056951) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is ethyl (Z)-3-[(2S,4R,5S)-5-[2-[(4S,5S)-5-(5-hydroxypent-3-ynyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(2S,4R,5S)-5-[2-[(4S,5S)-5-(5-hydroxypent-3-ynyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101056951 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | ethyl (Z)-3-[(2S,4R,5S)-5-[2-[(4S,5S)-5-(5-hydroxypent-3-ynyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl]-4-(methoxymethoxy)-4-methyloxolan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\[C@@H]1C[C@@](C)(OCOC)[C@H](CC[C@]2(C)OC(C)(C)O[C@H]2CCC#CCO)O1 |
| InChI | InChI=1S/C26H42O8/c1-8-30-23(28)19(2)16-20-17-26(6,31-18-29-7)21(32-20)13-14-25(5)22(12-10-9-11-15-27)33-24(3,4)34-25/h16,20-22,27H,8,10,12-15,17-18H2,1-7H3/b19-16-/t20-,21+,22+,25+,26-/m1/s1 |
| InChIKey | UUWSQOAJBNDSBX-IOAXMHNVSA-N |
| XLogP | 3.50 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|