C37H64O9 — CID 50942425
(2S)-4-[(13S)-14-[2-[(2S)-6-cyclohexyl-2-(methoxymethoxy)hexoxy]ethoxy]-8-hydroxy-13-(methoxymethoxy)tetradec-10-ynyl]-2-methyl-2H-furan-5-one (PubChem CID 50942425) has the molecular formula C37H64O9 and a molecular weight of 652.91 g/mol. Its IUPAC name is (2S)-4-[(13S)-14-[2-[(2S)-6-cyclohexyl-2-(methoxymethoxy)hexoxy]ethoxy]-8-hydroxy-13-(methoxymethoxy)tetradec-10-ynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(13S)-14-[2-[(2S)-6-cyclohexyl-2-(methoxymethoxy)hexoxy]ethoxy]-8-hydroxy-13-(methoxymethoxy)tetradec-10-ynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 50942425 |
| Molecular Formula | C37H64O9 |
| Molecular Weight | 652.91 g/mol |
| Exact Mass | 652.46 |
| IUPAC Name | (2S)-4-[(13S)-14-[2-[(2S)-6-cyclohexyl-2-(methoxymethoxy)hexoxy]ethoxy]-8-hydroxy-13-(methoxymethoxy)tetradec-10-ynyl]-2-methyl-2H-furan-5-one |
| SMILES | COCO[C@@H](CC#CCC(O)CCCCCCCC1=C[C@H](C)OC1=O)COCCOC[C@H](CCCCC1CCCCC1)OCOC |
| InChI | InChI=1S/C37H64O9/c1-31-26-33(37(39)46-31)19-10-5-4-6-11-20-34(38)21-13-15-23-36(45-30-41-3)28-43-25-24-42-27-35(44-29-40-2)22-14-12-18-32-16-8-7-9-17-32/h26,31-32,34-36,38H,4-12,14,16-25,27-30H2,1-3H3/t31-,34?,35-,36-/m0/s1 |
| InChIKey | AKFJMTLVSJUOOY-OOGNHZPUSA-N |
| XLogP | 6.89 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|