C22H30O5 — CID 10833246
(4S,7Z)-6-hydroxy-11-(methoxymethoxy)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-dien-9-yn-15-one (PubChem CID 10833246) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4S,7Z)-6-hydroxy-11-(methoxymethoxy)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-dien-9-yn-15-one.
| Compound Name | (4S,7Z)-6-hydroxy-11-(methoxymethoxy)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-dien-9-yn-15-one |
|---|---|
| PubChem CID | 10833246 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4S,7Z)-6-hydroxy-11-(methoxymethoxy)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-dien-9-yn-15-one |
| SMILES | C=C(C)[C@H]1CCC2=CC(CC(C)(OCOC)C#C/C=C(/C)C(O)C1)OC2=O |
| InChI | InChI=1S/C22H30O5/c1-15(2)17-8-9-18-11-19(27-21(18)24)13-22(4,26-14-25-5)10-6-7-16(3)20(23)12-17/h7,11,17,19-20,23H,1,8-9,12-14H2,2-5H3/b16-7-/t17-,19?,20?,22?/m0/s1 |
| InChIKey | HHNZPMNKIOMVJJ-ZGISZYNCSA-N |
| XLogP | 3.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|