C22H28O10 — CID 91098548
[(3aS)-9-acetyloxy-4,9-dihydroxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,5,8,11a-tetrahydrocyclodeca[b]furan-4-yl] 4-hydroxy-2-methylbut-2-enoate (PubChem CID 91098548) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is [(3aS)-9-acetyloxy-4,9-dihydroxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,5,8,11a-tetrahydrocyclodeca[b]furan-4-yl] 4-hydroxy-2-methylbut-2-enoate.
| Compound Name | [(3aS)-9-acetyloxy-4,9-dihydroxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,5,8,11a-tetrahydrocyclodeca[b]furan-4-yl] 4-hydroxy-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 91098548 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(3aS)-9-acetyloxy-4,9-dihydroxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,5,8,11a-tetrahydrocyclodeca[b]furan-4-yl] 4-hydroxy-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(C)C(O)(OC(C)=O)CC=C(CO)CC(O)(OC(=O)C(C)=CCO)[C@@H]12 |
| InChI | InChI=1S/C22H28O10/c1-12(6-8-23)19(26)32-22(29)10-16(11-24)5-7-21(28,31-15(4)25)13(2)9-17-18(22)14(3)20(27)30-17/h5-6,9,17-18,23-24,28-29H,3,7-8,10-11H2,1-2,4H3/t17?,18-,21?,22?/m0/s1 |
| InChIKey | KNBICPLFKBEMAT-PBWJLWFUSA-N |
| XLogP | 0.17 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|