C19H22ClNO4S — CID 134919067
methyl (2S,3R)-3-chloro-3-(2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 134919067) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is methyl (2S,3R)-3-chloro-3-(2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S,3R)-3-chloro-3-(2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 134919067 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl (2S,3R)-3-chloro-3-(2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](Cl)c1c(C)cccc1C |
| InChI | InChI=1S/C19H22ClNO4S/c1-12-8-10-15(11-9-12)26(23,24)21-18(19(22)25-4)17(20)16-13(2)6-5-7-14(16)3/h5-11,17-18,21H,1-4H3/t17-,18-/m1/s1 |
| InChIKey | ZRRRVPMMAWIYEQ-QZTJIDSGSA-N |
| XLogP | 3.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|