C27H27NO2 — CID 134919073
(5R)-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methylideneoxolan-2-one (PubChem CID 134919073) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (5R)-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methylideneoxolan-2-one.
| Compound Name | (5R)-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 134919073 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (5R)-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C[C@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)OC1=O |
| InChI | InChI=1S/C27H27NO2/c1-21-17-26(30-27(21)29)25(18-22-11-5-2-6-12-22)28(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-16,25-26H,1,17-20H2/t25-,26+/m0/s1 |
| InChIKey | VTPYWYCOWDSIGR-IZZNHLLZSA-N |
| XLogP | 5.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|