C19H30O2 — CID 134919549
4,5,7,8-tetrapropyl-2-oxabicyclo[4.2.0]octa-4,7-dien-3-one (PubChem CID 134919549) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4,5,7,8-tetrapropyl-2-oxabicyclo[4.2.0]octa-4,7-dien-3-one.
| Compound Name | 4,5,7,8-tetrapropyl-2-oxabicyclo[4.2.0]octa-4,7-dien-3-one |
|---|---|
| PubChem CID | 134919549 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 4,5,7,8-tetrapropyl-2-oxabicyclo[4.2.0]octa-4,7-dien-3-one |
| SMILES | CCCC1=C(CCC)C2C(CCC)=C(CCC)C2OC1=O |
| InChI | InChI=1S/C19H30O2/c1-5-9-13-15(11-7-3)18-17(13)14(10-6-2)16(12-8-4)19(20)21-18/h17-18H,5-12H2,1-4H3 |
| InChIKey | KILCZSXIGAEPRV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|