C22H32N2O4 — CID 134920092
5-O-tert-butyl 7-O-methyl 1-benzyl-5,7-dimethyl-2,3,6,7a-tetrahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate (PubChem CID 134920092) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-O-tert-butyl 7-O-methyl 1-benzyl-5,7-dimethyl-2,3,6,7a-tetrahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate.
| Compound Name | 5-O-tert-butyl 7-O-methyl 1-benzyl-5,7-dimethyl-2,3,6,7a-tetrahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
|---|---|
| PubChem CID | 134920092 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 5-O-tert-butyl 7-O-methyl 1-benzyl-5,7-dimethyl-2,3,6,7a-tetrahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
| SMILES | COC(=O)C1(C)CC(C)(C(=O)OC(C)(C)C)N2CCN(Cc3ccccc3)C21 |
| InChI | InChI=1S/C22H32N2O4/c1-20(2,3)28-19(26)22(5)15-21(4,18(25)27-6)17-23(12-13-24(17)22)14-16-10-8-7-9-11-16/h7-11,17H,12-15H2,1-6H3 |
| InChIKey | GZMCLNDWQXQNCY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |