C11H17N3O6S — CID 134920138
1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide;methyl sulfate (PubChem CID 134920138) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide;methyl sulfate.
| Compound Name | 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide;methyl sulfate |
|---|---|
| PubChem CID | 134920138 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[n+]1cc(C(N)=O)c(=O)n2c1CCCC2 |
| InChI | InChI=1S/C10H13N3O2.CH4O4S/c1-12-6-7(9(11)14)10(15)13-5-3-2-4-8(12)13;1-5-6(2,3)4/h6H,2-5H2,1H3,(H-,11,14);1H3,(H,2,3,4) |
| InChIKey | WDNJERVSPSWDGD-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|