C10H14N3O2+ — CID 13480644
1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide (PubChem CID 13480644) has the molecular formula C10H14N3O2+ and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide.
| Compound Name | 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 13480644 |
| Molecular Formula | C10H14N3O2+ |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-3-carboxamide |
| SMILES | C[n+]1cc(C(N)=O)c(=O)n2c1CCCC2 |
| InChI | InChI=1S/C10H13N3O2/c1-12-6-7(9(11)14)10(15)13-5-3-2-4-8(12)13/h6H,2-5H2,1H3,(H-,11,14)/p+1 |
| InChIKey | YDBIJMKBEASAPH-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 68.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|