C23H42OS — CID 134920723
(1S,2R,4R)-2-[(1Z,3Z)-2-methoxy-3-methylsulfanylundeca-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 134920723) has the molecular formula C23H42OS and a molecular weight of 366.66 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(1Z,3Z)-2-methoxy-3-methylsulfanylundeca-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(1Z,3Z)-2-methoxy-3-methylsulfanylundeca-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 134920723 |
| Molecular Formula | C23H42OS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (1S,2R,4R)-2-[(1Z,3Z)-2-methoxy-3-methylsulfanylundeca-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CCCCCCC/C=C(SC)/C(=C/[C@@H]1C[C@H](C)CC[C@H]1C(C)C)OC |
| InChI | InChI=1S/C23H42OS/c1-7-8-9-10-11-12-13-23(25-6)22(24-5)17-20-16-19(4)14-15-21(20)18(2)3/h13,17-21H,7-12,14-16H2,1-6H3/b22-17-,23-13-/t19-,20+,21+/m1/s1 |
| InChIKey | NSJXMOVPXUSEEO-JYBZJTLNSA-N |
| XLogP | 7.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|