C17H32OS — CID 15530592
(4Z,6Z)-8-ethyl-5-methoxy-2-methyl-6-methylsulfanyldodeca-4,6-diene (PubChem CID 15530592) has the molecular formula C17H32OS and a molecular weight of 284.51 g/mol. Its IUPAC name is (4Z,6Z)-8-ethyl-5-methoxy-2-methyl-6-methylsulfanyldodeca-4,6-diene.
| Compound Name | (4Z,6Z)-8-ethyl-5-methoxy-2-methyl-6-methylsulfanyldodeca-4,6-diene |
|---|---|
| PubChem CID | 15530592 |
| Molecular Formula | C17H32OS |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (4Z,6Z)-8-ethyl-5-methoxy-2-methyl-6-methylsulfanyldodeca-4,6-diene |
| SMILES | CCCCC(/C=C(SC)/C(=C/CC(C)C)OC)CC |
| InChI | InChI=1S/C17H32OS/c1-7-9-10-15(8-2)13-17(19-6)16(18-5)12-11-14(3)4/h12-15H,7-11H2,1-6H3/b16-12-,17-13- |
| InChIKey | CXNUMSQPSQKPQU-MCOFMCJXSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|