C20H36OS — CID 15530595
[(3Z,5Z)-7-ethyl-5-methylsulfanylundeca-3,5-dien-4-yl]oxycyclohexane (PubChem CID 15530595) has the molecular formula C20H36OS and a molecular weight of 324.57 g/mol. Its IUPAC name is [(3Z,5Z)-7-ethyl-5-methylsulfanylundeca-3,5-dien-4-yl]oxycyclohexane.
| Compound Name | [(3Z,5Z)-7-ethyl-5-methylsulfanylundeca-3,5-dien-4-yl]oxycyclohexane |
|---|---|
| PubChem CID | 15530595 |
| Molecular Formula | C20H36OS |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | [(3Z,5Z)-7-ethyl-5-methylsulfanylundeca-3,5-dien-4-yl]oxycyclohexane |
| SMILES | CC/C=C(OC1CCCCC1)/C(=C/C(CC)CCCC)SC |
| InChI | InChI=1S/C20H36OS/c1-5-8-13-17(7-3)16-20(22-4)19(12-6-2)21-18-14-10-9-11-15-18/h12,16-18H,5-11,13-15H2,1-4H3/b19-12-,20-16- |
| InChIKey | RRNXVQDSGHEHMC-SOHCQTMUSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|