C22H38OS — CID 134920907
[(1Z,3Z)-1-cyclohexyl-7-methyl-2-methylsulfanylocta-1,3-dien-3-yl]oxycyclohexane (PubChem CID 134920907) has the molecular formula C22H38OS and a molecular weight of 350.61 g/mol. Its IUPAC name is [(1Z,3Z)-1-cyclohexyl-7-methyl-2-methylsulfanylocta-1,3-dien-3-yl]oxycyclohexane.
| Compound Name | [(1Z,3Z)-1-cyclohexyl-7-methyl-2-methylsulfanylocta-1,3-dien-3-yl]oxycyclohexane |
|---|---|
| PubChem CID | 134920907 |
| Molecular Formula | C22H38OS |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | [(1Z,3Z)-1-cyclohexyl-7-methyl-2-methylsulfanylocta-1,3-dien-3-yl]oxycyclohexane |
| SMILES | CSC(=C\C1CCCCC1)/C(=C/CCC(C)C)OC1CCCCC1 |
| InChI | InChI=1S/C22H38OS/c1-18(2)11-10-16-21(23-20-14-8-5-9-15-20)22(24-3)17-19-12-6-4-7-13-19/h16-20H,4-15H2,1-3H3/b21-16-,22-17- |
| InChIKey | OEHFBQSEIJYDBF-QLBLWQCWSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|