C21H36OS — CID 15530594
[(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxycyclohexane (PubChem CID 15530594) has the molecular formula C21H36OS and a molecular weight of 336.59 g/mol. Its IUPAC name is [(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxycyclohexane.
| Compound Name | [(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxycyclohexane |
|---|---|
| PubChem CID | 15530594 |
| Molecular Formula | C21H36OS |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | [(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxycyclohexane |
| SMILES | CSC(=C\C1CCCCC1)/C(=C/CC(C)C)OC1CCCCC1 |
| InChI | InChI=1S/C21H36OS/c1-17(2)14-15-20(22-19-12-8-5-9-13-19)21(23-3)16-18-10-6-4-7-11-18/h15-19H,4-14H2,1-3H3/b20-15-,21-16- |
| InChIKey | VYGWLLLPBVUXCF-DRXLFAFDSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|