C25H44OS — CID 134920821
(1S,2R,4R)-2-[(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 134920821) has the molecular formula C25H44OS and a molecular weight of 392.69 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 134920821 |
| Molecular Formula | C25H44OS |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (1S,2R,4R)-2-[(1Z,3Z)-1-cyclohexyl-6-methyl-2-methylsulfanylhepta-1,3-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CSC(=C\C1CCCCC1)/C(=C/CC(C)C)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C25H44OS/c1-18(2)12-15-23(25(27-6)17-21-10-8-7-9-11-21)26-24-16-20(5)13-14-22(24)19(3)4/h15,17-22,24H,7-14,16H2,1-6H3/b23-15-,25-17-/t20-,22+,24-/m1/s1 |
| InChIKey | JZZNPYWPCHIIMO-OJVYIXSGSA-N |
| XLogP | 8.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|