C23H42OS — CID 101181291
(1S,2R,4R)-2-[(2Z,4E,6R)-6-ethyl-4-methylsulfanyldeca-2,4-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 101181291) has the molecular formula C23H42OS and a molecular weight of 366.66 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(2Z,4E,6R)-6-ethyl-4-methylsulfanyldeca-2,4-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(2Z,4E,6R)-6-ethyl-4-methylsulfanyldeca-2,4-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 101181291 |
| Molecular Formula | C23H42OS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (1S,2R,4R)-2-[(2Z,4E,6R)-6-ethyl-4-methylsulfanyldeca-2,4-dien-3-yl]oxy-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C/C=C(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)/C(=C\[C@H](CC)CCCC)SC |
| InChI | InChI=1S/C23H42OS/c1-8-11-12-19(9-2)16-23(25-7)21(10-3)24-22-15-18(6)13-14-20(22)17(4)5/h10,16-20,22H,8-9,11-15H2,1-7H3/b21-10-,23-16+/t18-,19-,20+,22-/m1/s1 |
| InChIKey | VMOYJCAGQIOZHH-ZVCKHXECSA-N |
| XLogP | 7.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|