C18H31OS+ — CID 145173370
[4-(cyclohexylmethoxy)cyclohexa-2,4-dien-1-yl]-pentylsulfanium (PubChem CID 145173370) has the molecular formula C18H31OS+ and a molecular weight of 295.51 g/mol. Its IUPAC name is [4-(cyclohexylmethoxy)cyclohexa-2,4-dien-1-yl]-pentylsulfanium.
| Compound Name | [4-(cyclohexylmethoxy)cyclohexa-2,4-dien-1-yl]-pentylsulfanium |
|---|---|
| PubChem CID | 145173370 |
| Molecular Formula | C18H31OS+ |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | [4-(cyclohexylmethoxy)cyclohexa-2,4-dien-1-yl]-pentylsulfanium |
| SMILES | CCCCC[SH+]C1C=CC(OCC2CCCCC2)=CC1 |
| InChI | InChI=1S/C18H30OS/c1-2-3-7-14-20-18-12-10-17(11-13-18)19-15-16-8-5-4-6-9-16/h10-12,16,18H,2-9,13-15H2,1H3/p+1 |
| InChIKey | OJVBTVYBTYUHCA-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|