C22H30OS — CID 142047007
(3R)-3-[(E)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylprop-1-enyl]-6-methyl-2-[(Z)-prop-1-enyl]-3,4,6,7-tetrahydro-2H-chromene (PubChem CID 142047007) has the molecular formula C22H30OS and a molecular weight of 342.55 g/mol. Its IUPAC name is (3R)-3-[(E)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylprop-1-enyl]-6-methyl-2-[(Z)-prop-1-enyl]-3,4,6,7-tetrahydro-2H-chromene.
| Compound Name | (3R)-3-[(E)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylprop-1-enyl]-6-methyl-2-[(Z)-prop-1-enyl]-3,4,6,7-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 142047007 |
| Molecular Formula | C22H30OS |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (3R)-3-[(E)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylprop-1-enyl]-6-methyl-2-[(Z)-prop-1-enyl]-3,4,6,7-tetrahydro-2H-chromene |
| SMILES | C/C=C\C(=C/C)SC/C=C/[C@H]1CC2=CC(C)CC=C2OC1/C=C\C |
| InChI | InChI=1S/C22H30OS/c1-5-9-20(7-3)24-14-8-11-18-16-19-15-17(4)12-13-22(19)23-21(18)10-6-2/h5-11,13,15,17-18,21H,12,14,16H2,1-4H3/b9-5-,10-6-,11-8+,20-7+/t17?,18-,21?/m0/s1 |
| InChIKey | XPZSJUBITDNMQQ-FPCDXBHOSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|