C18H25OS+ — CID 140711568
1-(4-butoxy-8,8a-dihydronaphthalen-1-yl)thiolan-1-ium (PubChem CID 140711568) has the molecular formula C18H25OS+ and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-(4-butoxy-8,8a-dihydronaphthalen-1-yl)thiolan-1-ium.
| Compound Name | 1-(4-butoxy-8,8a-dihydronaphthalen-1-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 140711568 |
| Molecular Formula | C18H25OS+ |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(4-butoxy-8,8a-dihydronaphthalen-1-yl)thiolan-1-ium |
| SMILES | CCCCOC1=CC=C([S+]2CCCC2)C2CC=CC=C12 |
| InChI | InChI=1S/C18H25OS/c1-2-3-12-19-17-10-11-18(20-13-6-7-14-20)16-9-5-4-8-15(16)17/h4-5,8,10-11,16H,2-3,6-7,9,12-14H2,1H3/q+1 |
| InChIKey | RABZKVBEDBMYEV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|