About ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium
ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium (PubChem CID 176920152) has the molecular formula C19H31OSV-
and a molecular weight of 358.47 g/mol. Its IUPAC name is ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium.
Molecular Properties
| Compound Name | ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium |
| PubChem CID | 176920152 |
| Molecular Formula | C19H31OSV- |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium |
| SMILES | CC.CC.CCC1=C(SC)c2c[c-]c(C(C)C)cc2OC1.[V] |
| InChI | InChI=1S/C15H19OS.2C2H6.V/c1-5-11-9-16-14-8-12(10(2)3)6-7-13(14)15(11)17-4;2*1-2;/h7-8,10H,5,9H2,1-4H3;2*1-2H3;/q-1;;; |
| InChIKey | SWXHZNGLKOZOKJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium?
The IUPAC name of ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium (CID 176920152) is ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium.
What is the SMILES notation for ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium?
The canonical SMILES for ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium is CC.CC.CCC1=C(SC)c2c[c-]c(C(C)C)cc2OC1.[V].
What is the InChIKey of ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium?
The InChIKey is SWXHZNGLKOZOKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19OS.2C2H6.V/c1-5-11-9-16-14-8-12(10(2)3)6-7-13(14)15(11)17-4;2*1-2;/h7-8,10H,5,9H2,1-4H3;2*1-2H3;/q-1;;;.
What are the key properties of ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium?
ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium has a molecular weight of 358.47 g/mol, XLogP of 6.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-4-methylsulfanyl-7-propan-2-yl-2,6-dihydrochromen-6-ide;vanadium is sourced from PubChem (CID 176920152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).