C15H28OS — CID 123600663
(4-butoxy-3,5-dimethylcyclohexa-1,3-dien-1-yl)-trimethyl-λ4-sulfane (PubChem CID 123600663) has the molecular formula C15H28OS and a molecular weight of 256.45 g/mol. Its IUPAC name is (4-butoxy-3,5-dimethylcyclohexa-1,3-dien-1-yl)-trimethyl-λ4-sulfane.
| Compound Name | (4-butoxy-3,5-dimethylcyclohexa-1,3-dien-1-yl)-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 123600663 |
| Molecular Formula | C15H28OS |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (4-butoxy-3,5-dimethylcyclohexa-1,3-dien-1-yl)-trimethyl-λ4-sulfane |
| SMILES | CCCCOC1=C(C)C=C(S(C)(C)C)CC1C |
| InChI | InChI=1S/C15H28OS/c1-7-8-9-16-15-12(2)10-14(11-13(15)3)17(4,5)6/h10,13H,7-9,11H2,1-6H3 |
| InChIKey | NVZHXMSIVQBXEE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|