C17H26OS — CID 123377328
5-(1-butoxyethylidene)-6-(1-propylsulfanylethylidene)cyclohexa-1,3-diene (PubChem CID 123377328) has the molecular formula C17H26OS and a molecular weight of 278.46 g/mol. Its IUPAC name is 5-(1-butoxyethylidene)-6-(1-propylsulfanylethylidene)cyclohexa-1,3-diene.
| Compound Name | 5-(1-butoxyethylidene)-6-(1-propylsulfanylethylidene)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123377328 |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5-(1-butoxyethylidene)-6-(1-propylsulfanylethylidene)cyclohexa-1,3-diene |
| SMILES | CCCCOC(C)=c1ccccc1=C(C)SCCC |
| InChI | InChI=1S/C17H26OS/c1-5-7-12-18-14(3)16-10-8-9-11-17(16)15(4)19-13-6-2/h8-11H,5-7,12-13H2,1-4H3 |
| InChIKey | VZAMUSBDNNNFBT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|