C13H20OS — CID 142084432
(3Z)-5-[(3E)-hexa-3,5-dien-3-yl]oxy-3-(methylsulfanylmethylidene)pent-1-ene (PubChem CID 142084432) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is (3Z)-5-[(3E)-hexa-3,5-dien-3-yl]oxy-3-(methylsulfanylmethylidene)pent-1-ene.
| Compound Name | (3Z)-5-[(3E)-hexa-3,5-dien-3-yl]oxy-3-(methylsulfanylmethylidene)pent-1-ene |
|---|---|
| PubChem CID | 142084432 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3Z)-5-[(3E)-hexa-3,5-dien-3-yl]oxy-3-(methylsulfanylmethylidene)pent-1-ene |
| SMILES | C=C/C=C(\CC)OCC/C(C=C)=C/SC |
| InChI | InChI=1S/C13H20OS/c1-5-8-13(7-3)14-10-9-12(6-2)11-15-4/h5-6,8,11H,1-2,7,9-10H2,3-4H3/b12-11+,13-8+ |
| InChIKey | NJVAVXDJIAKRNN-FYXALXGLSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|