C14H20OS — CID 144839159
(1E,3E,4Z,7E)-3-(methoxymethylidene)-5-prop-1-en-2-ylnona-1,4,7-triene-1-thiol (PubChem CID 144839159) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is (1E,3E,4Z,7E)-3-(methoxymethylidene)-5-prop-1-en-2-ylnona-1,4,7-triene-1-thiol.
| Compound Name | (1E,3E,4Z,7E)-3-(methoxymethylidene)-5-prop-1-en-2-ylnona-1,4,7-triene-1-thiol |
|---|---|
| PubChem CID | 144839159 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (1E,3E,4Z,7E)-3-(methoxymethylidene)-5-prop-1-en-2-ylnona-1,4,7-triene-1-thiol |
| SMILES | C=C(C)/C(=C/C(/C=C/S)=C\OC)C/C=C/C |
| InChI | InChI=1S/C14H20OS/c1-5-6-7-14(12(2)3)10-13(8-9-16)11-15-4/h5-6,8-11,16H,2,7H2,1,3-4H3/b6-5+,9-8+,13-11-,14-10- |
| InChIKey | MPZCSCQYYNZXAX-NMSLLWTASA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|