C12H20OS — CID 91496081
5-ethoxy-6,7-dimethylocta-2,5,7-triene-1-thiol (PubChem CID 91496081) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 5-ethoxy-6,7-dimethylocta-2,5,7-triene-1-thiol.
| Compound Name | 5-ethoxy-6,7-dimethylocta-2,5,7-triene-1-thiol |
|---|---|
| PubChem CID | 91496081 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-ethoxy-6,7-dimethylocta-2,5,7-triene-1-thiol |
| SMILES | C=C(C)C(C)=C(CC=CCS)OCC |
| InChI | InChI=1S/C12H20OS/c1-5-13-12(8-6-7-9-14)11(4)10(2)3/h6-7,14H,2,5,8-9H2,1,3-4H3 |
| InChIKey | VUQFEJWGXMFACI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|