C11H20OS — CID 90959287
6-methoxy-2,3-dimethylocta-3,5-diene-1-thiol (PubChem CID 90959287) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 6-methoxy-2,3-dimethylocta-3,5-diene-1-thiol.
| Compound Name | 6-methoxy-2,3-dimethylocta-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 90959287 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 6-methoxy-2,3-dimethylocta-3,5-diene-1-thiol |
| SMILES | CCC(=CC=C(C)C(C)CS)OC |
| InChI | InChI=1S/C11H20OS/c1-5-11(12-4)7-6-9(2)10(3)8-13/h6-7,10,13H,5,8H2,1-4H3 |
| InChIKey | JPHUBKBCRNZGTM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|