About ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol
ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol (PubChem CID 145126056) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol.
Molecular Properties
| Compound Name | ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol |
| PubChem CID | 145126056 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol |
| SMILES | C/C=C(C#CCS)\C=C(/C)OC.CC.CC |
| InChI | InChI=1S/C10H14OS.2C2H6/c1-4-10(6-5-7-12)8-9(2)11-3;2*1-2/h4,8,12H,7H2,1-3H3;2*1-2H3/b9-8+,10-4-;; |
| InChIKey | KDTFHPHBRBBRAJ-OIHDPVLJSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol?
The IUPAC name of ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol (CID 145126056) is ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol.
What is the SMILES notation for ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol?
The canonical SMILES for ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol is C/C=C(C#CCS)\C=C(/C)OC.CC.CC.
What is the InChIKey of ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol?
The InChIKey is KDTFHPHBRBBRAJ-OIHDPVLJSA-N. The full InChI is InChI=1S/C10H14OS.2C2H6/c1-4-10(6-5-7-12)8-9(2)11-3;2*1-2/h4,8,12H,7H2,1-3H3;2*1-2H3/b9-8+,10-4-;;.
What are the key properties of ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol?
ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol has a molecular weight of 242.43 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E,4E)-4-ethylidene-6-methoxyhept-5-en-2-yne-1-thiol is sourced from PubChem (CID 145126056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).