C12H24O — CID 143202991
ethane;(2E,4E)-2-methoxy-5,6-dimethylhepta-2,4-diene (PubChem CID 143202991) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is ethane;(2E,4E)-2-methoxy-5,6-dimethylhepta-2,4-diene.
| Compound Name | ethane;(2E,4E)-2-methoxy-5,6-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 143202991 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | ethane;(2E,4E)-2-methoxy-5,6-dimethylhepta-2,4-diene |
| SMILES | CC.CO/C(C)=C/C=C(\C)C(C)C |
| InChI | InChI=1S/C10H18O.C2H6/c1-8(2)9(3)6-7-10(4)11-5;1-2/h6-8H,1-5H3;1-2H3/b9-6+,10-7+; |
| InChIKey | MHGBJRGRBASQSJ-BHSKDUGMSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|