C13H21FO — CID 90998043
8-(fluoromethoxy)-2,4-dimethyldeca-2,5,7-triene (PubChem CID 90998043) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is 8-(fluoromethoxy)-2,4-dimethyldeca-2,5,7-triene.
| Compound Name | 8-(fluoromethoxy)-2,4-dimethyldeca-2,5,7-triene |
|---|---|
| PubChem CID | 90998043 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 8-(fluoromethoxy)-2,4-dimethyldeca-2,5,7-triene |
| SMILES | CCC(=CC=CC(C)C=C(C)C)OCF |
| InChI | InChI=1S/C13H21FO/c1-5-13(15-10-14)8-6-7-12(4)9-11(2)3/h6-9,12H,5,10H2,1-4H3 |
| InChIKey | WUWNKVNIHDMGIW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|