C14H23FO — CID 90803999
3-ethyl-6-(2-fluoro-2-methylbutoxy)hepta-1,3,5-triene (PubChem CID 90803999) has the molecular formula C14H23FO and a molecular weight of 226.33 g/mol. Its IUPAC name is 3-ethyl-6-(2-fluoro-2-methylbutoxy)hepta-1,3,5-triene.
| Compound Name | 3-ethyl-6-(2-fluoro-2-methylbutoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 90803999 |
| Molecular Formula | C14H23FO |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-ethyl-6-(2-fluoro-2-methylbutoxy)hepta-1,3,5-triene |
| SMILES | C=CC(=CC=C(C)OCC(C)(F)CC)CC |
| InChI | InChI=1S/C14H23FO/c1-6-13(7-2)10-9-12(4)16-11-14(5,15)8-3/h6,9-10H,1,7-8,11H2,2-5H3 |
| InChIKey | YSXSMEGHARUCRJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|