C13H20OS — CID 144599318
(Z,2R)-2-cyclohexa-1,5-dien-1-yl-3-ethoxypent-3-ene-1-thiol (PubChem CID 144599318) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is (Z,2R)-2-cyclohexa-1,5-dien-1-yl-3-ethoxypent-3-ene-1-thiol.
| Compound Name | (Z,2R)-2-cyclohexa-1,5-dien-1-yl-3-ethoxypent-3-ene-1-thiol |
|---|---|
| PubChem CID | 144599318 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (Z,2R)-2-cyclohexa-1,5-dien-1-yl-3-ethoxypent-3-ene-1-thiol |
| SMILES | C/C=C(\OCC)[C@H](CS)C1=CCCC=C1 |
| InChI | InChI=1S/C13H20OS/c1-3-13(14-4-2)12(10-15)11-8-6-5-7-9-11/h3,6,8-9,12,15H,4-5,7,10H2,1-2H3/b13-3-/t12-/m1/s1 |
| InChIKey | BEXVPAXRLKEYST-PXFUOSDGSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|