C8H12OS — CID 143497837
2-ethoxycyclohexa-2,4-diene-1-thiol (PubChem CID 143497837) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-ethoxycyclohexa-2,4-diene-1-thiol.
| Compound Name | 2-ethoxycyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 143497837 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-ethoxycyclohexa-2,4-diene-1-thiol |
| SMILES | CCOC1=CC=CCC1S |
| InChI | InChI=1S/C8H12OS/c1-2-9-7-5-3-4-6-8(7)10/h3-5,8,10H,2,6H2,1H3 |
| InChIKey | WPOYZJYAMHSTAV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|