C10H14OS — CID 142289129
4-cyclohexa-1,3-dien-1-yloxybut-1-ene-2-thiol (PubChem CID 142289129) has the molecular formula C10H14OS and a molecular weight of 182.29 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yloxybut-1-ene-2-thiol.
| Compound Name | 4-cyclohexa-1,3-dien-1-yloxybut-1-ene-2-thiol |
|---|---|
| PubChem CID | 142289129 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yloxybut-1-ene-2-thiol |
| SMILES | C=C(S)CCOC1=CC=CCC1 |
| InChI | InChI=1S/C10H14OS/c1-9(12)7-8-11-10-5-3-2-4-6-10/h2-3,5,12H,1,4,6-8H2 |
| InChIKey | UMTXEHORMHCWPA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|