C12H14O2 — CID 13032212
1-(2-cyclopenta-1,3-dien-1-yloxyethoxy)cyclopenta-1,3-diene (PubChem CID 13032212) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-(2-cyclopenta-1,3-dien-1-yloxyethoxy)cyclopenta-1,3-diene.
| Compound Name | 1-(2-cyclopenta-1,3-dien-1-yloxyethoxy)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 13032212 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(2-cyclopenta-1,3-dien-1-yloxyethoxy)cyclopenta-1,3-diene |
| SMILES | C1=CCC(OCCOC2=CC=CC2)=C1 |
| InChI | InChI=1S/C12H14O2/c1-2-6-11(5-1)13-9-10-14-12-7-3-4-8-12/h1-5,7H,6,8-10H2 |
| InChIKey | HKMXGMXWGKOOEG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|