C8H10O3 — CID 173452808
2-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-one (PubChem CID 173452808) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-one.
| Compound Name | 2-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 173452808 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1CC=CC=C1OCCO |
| InChI | InChI=1S/C8H10O3/c9-5-6-11-8-4-2-1-3-7(8)10/h1-2,4,9H,3,5-6H2 |
| InChIKey | GAMUFMPVBREGJX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |