C90H108O18 — CID 101033118
6-[3,6,7,10,11-pentakis[6-(cyclopenta-1,3-diene-1-carbonyloxy)hexoxy]triphenylen-2-yl]oxyhexyl cyclopenta-1,3-diene-1-carboxylate (PubChem CID 101033118) has the molecular formula C90H108O18 and a molecular weight of 1477.84 g/mol. Its IUPAC name is 6-[3,6,7,10,11-pentakis[6-(cyclopenta-1,3-diene-1-carbonyloxy)hexoxy]triphenylen-2-yl]oxyhexyl cyclopenta-1,3-diene-1-carboxylate.
| Compound Name | 6-[3,6,7,10,11-pentakis[6-(cyclopenta-1,3-diene-1-carbonyloxy)hexoxy]triphenylen-2-yl]oxyhexyl cyclopenta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 101033118 |
| Molecular Formula | C90H108O18 |
| Molecular Weight | 1477.84 g/mol |
| Exact Mass | 1476.75 |
| IUPAC Name | 6-[3,6,7,10,11-pentakis[6-(cyclopenta-1,3-diene-1-carbonyloxy)hexoxy]triphenylen-2-yl]oxyhexyl cyclopenta-1,3-diene-1-carboxylate |
| SMILES | O=C(OCCCCCCOc1cc2c3cc(OCCCCCCOC(=O)C4=CC=CC4)c(OCCCCCCOC(=O)C4=CC=CC4)cc3c3cc(OCCCCCCOC(=O)C4=CC=CC4)c(OCCCCCCOC(=O)C4=CC=CC4)cc3c2cc1OCCCCCCOC(=O)C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C90H108O18/c91-85(67-37-13-14-38-67)103-55-31-7-1-25-49-97-79-61-73-74(62-80(79)98-50-26-2-8-32-56-104-86(92)68-39-15-16-40-68)76-64-82(100-52-28-4-10-34-58-106-88(94)70-43-19-20-44-70)84(102-54-30-6-12-36-60-108-90(96)72-47-23-24-48-72)66-78(76)77-65-83(101-53-29-5-11-35-59-107-89(95)71-45-21-22-46-71)81(63-75(73)77)99-51-27-3-9-33-57-105-87(93)69-41-17-18-42-69/h13-24,37,39,41,43,45,47,61-66H,1-12,25-36,38,40,42,44,46,48-60H2 |
| InChIKey | KYAJGFOEGMSEMN-UHFFFAOYSA-N |
| XLogP | 19.36 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 108 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1477.84 |
| LogP ≤ 5 | 19.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|