C56H76O8S4 — CID 101033119
6-(6,7,10,11-tetrahexoxy-3-methoxytriphenylen-2-yl)oxyhexyl 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 101033119) has the molecular formula C56H76O8S4 and a molecular weight of 1005.48 g/mol. Its IUPAC name is 6-(6,7,10,11-tetrahexoxy-3-methoxytriphenylen-2-yl)oxyhexyl 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate.
| Compound Name | 6-(6,7,10,11-tetrahexoxy-3-methoxytriphenylen-2-yl)oxyhexyl 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 101033119 |
| Molecular Formula | C56H76O8S4 |
| Molecular Weight | 1005.48 g/mol |
| Exact Mass | 1004.44 |
| IUPAC Name | 6-(6,7,10,11-tetrahexoxy-3-methoxytriphenylen-2-yl)oxyhexyl 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | CCCCCCOc1cc2c3cc(OC)c(OCCCCCCOC(=O)C4=CSC(=C5SC=CS5)S4)cc3c3cc(OCCCCCC)c(OCCCCCC)cc3c2cc1OCCCCCC |
| InChI | InChI=1S/C56H76O8S4/c1-6-10-14-20-26-60-49-36-43-41-34-47(58-5)48(59-30-24-18-19-25-31-64-54(57)53-40-67-56(68-53)55-65-32-33-66-55)35-42(41)44-37-50(61-27-21-15-11-7-2)52(63-29-23-17-13-9-4)39-46(44)45(43)38-51(49)62-28-22-16-12-8-3/h32-40H,6-31H2,1-5H3 |
| InChIKey | FGOXCONXSLJXFS-UHFFFAOYSA-N |
| XLogP | 17.87 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.48 |
| LogP ≤ 5 | 17.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|